C23H25NO5 — CID 70974571
1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 70974571) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70974571 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(C(=O)O)CC1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-23(2,3)29-22(28)24-18(14-19(20(24)25)21(26)27)13-15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,18-19H,13-14H2,1-3H3,(H,26,27) |
| InChIKey | PAFHREOZBWYAGE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|