C27H33NO4 — CID 53312072
tert-butyl (5S)-3-(2,2-dimethylpropanoyl)-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 53312072) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is tert-butyl (5S)-3-(2,2-dimethylpropanoyl)-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-3-(2,2-dimethylpropanoyl)-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53312072 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl (5S)-3-(2,2-dimethylpropanoyl)-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(C(=O)C(C)(C)C)C[C@H]1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H33NO4/c1-26(2,3)23(29)22-17-21(28(24(22)30)25(31)32-27(4,5)6)16-18-12-14-20(15-13-18)19-10-8-7-9-11-19/h7-15,21-22H,16-17H2,1-6H3/t21-,22?/m1/s1 |
| InChIKey | FMJCDVJOQAZBGL-ZMFCMNQTSA-N |
| XLogP | 5.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|