C23H24FNO4 — CID 123146369
tert-butyl (5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidine-1-carboxylate (PubChem CID 123146369) has the molecular formula C23H24FNO4 and a molecular weight of 397.45 g/mol. Its IUPAC name is tert-butyl (5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123146369 |
| Molecular Formula | C23H24FNO4 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl (5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(C=O)C[C@H]1Cc1ccc(-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H24FNO4/c1-23(2,3)29-22(28)25-20(13-18(14-26)21(25)27)11-15-7-9-16(10-8-15)17-5-4-6-19(24)12-17/h4-10,12,14,18,20H,11,13H2,1-3H3/t18?,20-/m1/s1 |
| InChIKey | DUHQXVFLGGNNFL-ROPPNANJSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|