C26H32N2O3 — CID 143834416
tert-butyl (5R)-3-[2-(dimethylamino)ethylidene]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 143834416) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl (5R)-3-[2-(dimethylamino)ethylidene]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-3-[2-(dimethylamino)ethylidene]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143834416 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl (5R)-3-[2-(dimethylamino)ethylidene]-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)CC=C1C[C@@H](Cc2ccc(-c3ccccc3)cc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C26H32N2O3/c1-26(2,3)31-25(30)28-23(18-22(24(28)29)15-16-27(4)5)17-19-11-13-21(14-12-19)20-9-7-6-8-10-20/h6-15,23H,16-18H2,1-5H3/t23-/m1/s1 |
| InChIKey | IOGOYUXCPMYLDC-HSZRJFAPSA-N |
| XLogP | 4.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|