C30H29FN2O5 — CID 172551955
tert-butyl 2-[[3-(dibenzoylamino)-4-fluorophenyl]methyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 172551955) has the molecular formula C30H29FN2O5 and a molecular weight of 516.57 g/mol. Its IUPAC name is tert-butyl 2-[[3-(dibenzoylamino)-4-fluorophenyl]methyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-(dibenzoylamino)-4-fluorophenyl]methyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172551955 |
| Molecular Formula | C30H29FN2O5 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | tert-butyl 2-[[3-(dibenzoylamino)-4-fluorophenyl]methyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC1Cc1ccc(F)c(N(C(=O)c2ccccc2)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H29FN2O5/c1-30(2,3)38-29(37)32-23(15-17-26(32)34)18-20-14-16-24(31)25(19-20)33(27(35)21-10-6-4-7-11-21)28(36)22-12-8-5-9-13-22/h4-14,16,19,23H,15,17-18H2,1-3H3 |
| InChIKey | NVRCFDPSYTYRTO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|