C16H19BrClNO3 — CID 118261018
tert-butyl 2-[(4-bromo-2-chlorophenyl)methyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 118261018) has the molecular formula C16H19BrClNO3 and a molecular weight of 388.69 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromo-2-chlorophenyl)methyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-bromo-2-chlorophenyl)methyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118261018 |
| Molecular Formula | C16H19BrClNO3 |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | tert-butyl 2-[(4-bromo-2-chlorophenyl)methyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H19BrClNO3/c1-16(2,3)22-15(21)19-12(6-7-14(19)20)8-10-4-5-11(17)9-13(10)18/h4-5,9,12H,6-8H2,1-3H3 |
| InChIKey | MYGSRVFMZMUCRO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |