C27H31NO6 — CID 134841951
tert-butyl (5S)-2-oxo-5-[(2,3,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 134841951) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is tert-butyl (5S)-2-oxo-5-[(2,3,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-oxo-5-[(2,3,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134841951 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | tert-butyl (5S)-2-oxo-5-[(2,3,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc2c(C[C@@H]3CCC(=O)N3C(=O)OC(C)(C)C)cc3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C27H31NO6/c1-27(2,3)34-26(30)28-18(7-10-25(28)29)12-16-11-17-13-23(32-5)24(33-6)15-21(17)22-14-19(31-4)8-9-20(16)22/h8-9,11,13-15,18H,7,10,12H2,1-6H3/t18-/m0/s1 |
| InChIKey | RVBJPJJWRVWVSR-SFHVURJKSA-N |
| XLogP | 5.49 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|