C26H31NO4 — CID 71507489
tert-butyl (2S)-2-[(3,6-dimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 71507489) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3,6-dimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3,6-dimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71507489 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | tert-butyl (2S)-2-[(3,6-dimethoxyphenanthren-9-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc2cc(C[C@@H]3CCCN3C(=O)OC(C)(C)C)c3ccc(OC)cc3c2c1 |
| InChI | InChI=1S/C26H31NO4/c1-26(2,3)31-25(28)27-12-6-7-19(27)14-18-13-17-8-9-20(29-4)15-23(17)24-16-21(30-5)10-11-22(18)24/h8-11,13,15-16,19H,6-7,12,14H2,1-5H3/t19-/m0/s1 |
| InChIKey | SOIKSCXCLMLPKJ-IBGZPJMESA-N |
| XLogP | 5.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|