C24H28N2O3 — CID 175483366
tert-butyl 2-[(8-methoxyphenanthridin-6-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 175483366) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is tert-butyl 2-[(8-methoxyphenanthridin-6-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(8-methoxyphenanthridin-6-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175483366 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | tert-butyl 2-[(8-methoxyphenanthridin-6-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc2c(c1)c(CC1CCCN1C(=O)OC(C)(C)C)nc1ccccc12 |
| InChI | InChI=1S/C24H28N2O3/c1-24(2,3)29-23(27)26-13-7-8-16(26)14-22-20-15-17(28-4)11-12-18(20)19-9-5-6-10-21(19)25-22/h5-6,9-12,15-16H,7-8,13-14H2,1-4H3 |
| InChIKey | DRFWPMZPKDMECZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|