C27H33NO4 — CID 71507490
tert-butyl 2-[(3,6-dimethoxyphenanthren-9-yl)methyl]piperidine-1-carboxylate (PubChem CID 71507490) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is tert-butyl 2-[(3,6-dimethoxyphenanthren-9-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(3,6-dimethoxyphenanthren-9-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71507490 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl 2-[(3,6-dimethoxyphenanthren-9-yl)methyl]piperidine-1-carboxylate |
| SMILES | COc1ccc2cc(CC3CCCCN3C(=O)OC(C)(C)C)c3ccc(OC)cc3c2c1 |
| InChI | InChI=1S/C27H33NO4/c1-27(2,3)32-26(29)28-13-7-6-8-20(28)15-19-14-18-9-10-21(30-4)16-24(18)25-17-22(31-5)11-12-23(19)25/h9-12,14,16-17,20H,6-8,13,15H2,1-5H3 |
| InChIKey | FIORXSZFTSSNIV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|