C19H29NO4 — CID 67289222
tert-butyl (2S)-2-[(1S)-2-hydroxy-1-(4-methoxyphenyl)ethyl]piperidine-1-carboxylate (PubChem CID 67289222) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1S)-2-hydroxy-1-(4-methoxyphenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1S)-2-hydroxy-1-(4-methoxyphenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67289222 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl (2S)-2-[(1S)-2-hydroxy-1-(4-methoxyphenyl)ethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc([C@H](CO)[C@@H]2CCCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-19(2,3)24-18(22)20-12-6-5-7-17(20)16(13-21)14-8-10-15(23-4)11-9-14/h8-11,16-17,21H,5-7,12-13H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | JVPOZXKWJHXBAI-IRXDYDNUSA-N |
| XLogP | 3.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |