C23H26N2O6 — CID 156904102
tert-butyl (2R)-2-[(3-nitro-4-phenylmethoxyphenyl)methyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 156904102) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3-nitro-4-phenylmethoxyphenyl)methyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3-nitro-4-phenylmethoxyphenyl)methyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156904102 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | tert-butyl (2R)-2-[(3-nitro-4-phenylmethoxyphenyl)methyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@@H]1Cc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N2O6/c1-23(2,3)31-22(27)24-18(10-12-21(24)26)13-17-9-11-20(19(14-17)25(28)29)30-15-16-7-5-4-6-8-16/h4-9,11,14,18H,10,12-13,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | PEXCGJCLDLWGPK-GOSISDBHSA-N |
| XLogP | 4.64 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|