C21H26N2O3 — CID 54404368
3,4-dimethyl-1-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]pyrrolidine (PubChem CID 54404368) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3,4-dimethyl-1-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]pyrrolidine.
| Compound Name | 3,4-dimethyl-1-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 54404368 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3,4-dimethyl-1-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]pyrrolidine |
| SMILES | CC1CN(CCc2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)CC1C |
| InChI | InChI=1S/C21H26N2O3/c1-16-13-22(14-17(16)2)11-10-18-8-9-21(20(12-18)23(24)25)26-15-19-6-4-3-5-7-19/h3-9,12,16-17H,10-11,13-15H2,1-2H3 |
| InChIKey | VPPXODIFIJPCMN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|