C25H37N2O3+ — CID 70392929
butan-2-yl-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]-dipropylazanium (PubChem CID 70392929) has the molecular formula C25H37N2O3+ and a molecular weight of 413.58 g/mol. Its IUPAC name is butan-2-yl-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]-dipropylazanium.
| Compound Name | butan-2-yl-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]-dipropylazanium |
|---|---|
| PubChem CID | 70392929 |
| Molecular Formula | C25H37N2O3+ |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | butan-2-yl-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]-dipropylazanium |
| SMILES | CCC[N+](CCC)(CCc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1)C(C)CC |
| InChI | InChI=1S/C25H37N2O3/c1-5-16-27(17-6-2,21(4)7-3)18-15-22-13-14-25(24(19-22)26(28)29)30-20-23-11-9-8-10-12-23/h8-14,19,21H,5-7,15-18,20H2,1-4H3/q+1 |
| InChIKey | NGDVHWZWUGUEAN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|