C26H31N3O3 — CID 70411446
4-[2-[1-(3-nitro-4-phenylmethoxyphenyl)pentylamino]ethyl]aniline (PubChem CID 70411446) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[2-[1-(3-nitro-4-phenylmethoxyphenyl)pentylamino]ethyl]aniline.
| Compound Name | 4-[2-[1-(3-nitro-4-phenylmethoxyphenyl)pentylamino]ethyl]aniline |
|---|---|
| PubChem CID | 70411446 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 4-[2-[1-(3-nitro-4-phenylmethoxyphenyl)pentylamino]ethyl]aniline |
| SMILES | CCCCC(NCCc1ccc(N)cc1)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-3-9-24(28-17-16-20-10-13-23(27)14-11-20)22-12-15-26(25(18-22)29(30)31)32-19-21-7-5-4-6-8-21/h4-8,10-15,18,24,28H,2-3,9,16-17,19,27H2,1H3 |
| InChIKey | HVNZPOVUOJEHHI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|