C29H36N2O2 — CID 70412384
N-[3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]hexyl]phenyl]acetamide (PubChem CID 70412384) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]hexyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]hexyl]phenyl]acetamide |
|---|---|
| PubChem CID | 70412384 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]hexyl]phenyl]acetamide |
| SMILES | CCCCCC(NCCc1ccc(OCc2ccccc2)cc1)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C29H36N2O2/c1-3-4-6-14-29(26-12-9-13-27(21-26)31-23(2)32)30-20-19-24-15-17-28(18-16-24)33-22-25-10-7-5-8-11-25/h5,7-13,15-18,21,29-30H,3-4,6,14,19-20,22H2,1-2H3,(H,31,32) |
| InChIKey | JVPZBKRDVFOYOX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|