About 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one
3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one (PubChem CID 142081046) has the molecular formula C25H34O3
and a molecular weight of 382.54 g/mol. Its IUPAC name is 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one.
Molecular Properties
| Compound Name | 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one |
| PubChem CID | 142081046 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one |
| SMILES | CC(=O)Cc1ccc(OCc2ccccc2)cc1.CCCCCC(C)C(C)=O |
| InChI | InChI=1S/C16H16O2.C9H18O/c1-13(17)11-14-7-9-16(10-8-14)18-12-15-5-3-2-4-6-15;1-4-5-6-7-8(2)9(3)10/h2-10H,11-12H2,1H3;8H,4-7H2,1-3H3 |
| InChIKey | IVEIVKJGIGDNKN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one?
The IUPAC name of 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one (CID 142081046) is 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one.
What is the SMILES notation for 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one?
The canonical SMILES for 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one is CC(=O)Cc1ccc(OCc2ccccc2)cc1.CCCCCC(C)C(C)=O.
What is the InChIKey of 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one?
The InChIKey is IVEIVKJGIGDNKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2.C9H18O/c1-13(17)11-14-7-9-16(10-8-14)18-12-15-5-3-2-4-6-15;1-4-5-6-7-8(2)9(3)10/h2-10H,11-12H2,1H3;8H,4-7H2,1-3H3.
What are the key properties of 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one?
3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one has a molecular weight of 382.54 g/mol, XLogP of 6.19, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctan-2-one;1-(4-phenylmethoxyphenyl)propan-2-one is sourced from PubChem (CID 142081046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).