C24H32O3 — CID 150364577
octan-3-yl 2-(4-phenylmethoxyphenyl)propanoate (PubChem CID 150364577) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is octan-3-yl 2-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | octan-3-yl 2-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 150364577 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | octan-3-yl 2-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCCCCC(CC)OC(=O)C(C)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32O3/c1-4-6-8-13-22(5-2)27-24(25)19(3)21-14-16-23(17-15-21)26-18-20-11-9-7-10-12-20/h7,9-12,14-17,19,22H,4-6,8,13,18H2,1-3H3 |
| InChIKey | GWKRZXDPCYXOJM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|