C27H33N3O2 — CID 88645298
1-phenyl-3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]pentyl]urea (PubChem CID 88645298) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-phenyl-3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]pentyl]urea.
| Compound Name | 1-phenyl-3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]pentyl]urea |
|---|---|
| PubChem CID | 88645298 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-phenyl-3-[1-[2-(4-phenylmethoxyphenyl)ethylamino]pentyl]urea |
| SMILES | CCCCC(NCCc1ccc(OCc2ccccc2)cc1)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H33N3O2/c1-2-3-14-26(30-27(31)29-24-12-8-5-9-13-24)28-20-19-22-15-17-25(18-16-22)32-21-23-10-6-4-7-11-23/h4-13,15-18,26,28H,2-3,14,19-21H2,1H3,(H2,29,30,31) |
| InChIKey | MDLRVUPCMRFJDX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|