C33H36N2O4 — CID 54125663
2-(3-nitro-4-phenylmethoxyphenyl)-N-[2-(4-phenylmethoxy-2-propylphenyl)ethyl]ethanamine (PubChem CID 54125663) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-(3-nitro-4-phenylmethoxyphenyl)-N-[2-(4-phenylmethoxy-2-propylphenyl)ethyl]ethanamine.
| Compound Name | 2-(3-nitro-4-phenylmethoxyphenyl)-N-[2-(4-phenylmethoxy-2-propylphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 54125663 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 2-(3-nitro-4-phenylmethoxyphenyl)-N-[2-(4-phenylmethoxy-2-propylphenyl)ethyl]ethanamine |
| SMILES | CCCc1cc(OCc2ccccc2)ccc1CCNCCc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H36N2O4/c1-2-9-30-23-31(38-24-27-10-5-3-6-11-27)16-15-29(30)19-21-34-20-18-26-14-17-33(32(22-26)35(36)37)39-25-28-12-7-4-8-13-28/h3-8,10-17,22-23,34H,2,9,18-21,24-25H2,1H3 |
| InChIKey | NQTUETTUNNRZAV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|