C35H41N3O3 — CID 70412957
[5-[2-[2-(2-butyl-4-phenylmethoxyphenyl)ethylamino]ethyl]-2-phenylmethoxyphenyl]urea (PubChem CID 70412957) has the molecular formula C35H41N3O3 and a molecular weight of 551.73 g/mol. Its IUPAC name is [5-[2-[2-(2-butyl-4-phenylmethoxyphenyl)ethylamino]ethyl]-2-phenylmethoxyphenyl]urea.
| Compound Name | [5-[2-[2-(2-butyl-4-phenylmethoxyphenyl)ethylamino]ethyl]-2-phenylmethoxyphenyl]urea |
|---|---|
| PubChem CID | 70412957 |
| Molecular Formula | C35H41N3O3 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | [5-[2-[2-(2-butyl-4-phenylmethoxyphenyl)ethylamino]ethyl]-2-phenylmethoxyphenyl]urea |
| SMILES | CCCCc1cc(OCc2ccccc2)ccc1CCNCCc1ccc(OCc2ccccc2)c(NC(N)=O)c1 |
| InChI | InChI=1S/C35H41N3O3/c1-2-3-14-31-24-32(40-25-28-10-6-4-7-11-28)17-16-30(31)20-22-37-21-19-27-15-18-34(33(23-27)38-35(36)39)41-26-29-12-8-5-9-13-29/h4-13,15-18,23-24,37H,2-3,14,19-22,25-26H2,1H3,(H3,36,38,39) |
| InChIKey | SILGYFFXWUFFGP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|