C28H35N3O2 — CID 57124072
1-methyl-3-[5-[2-[2-phenylethyl(propyl)amino]ethyl]-2-phenylmethoxyphenyl]urea (PubChem CID 57124072) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-methyl-3-[5-[2-[2-phenylethyl(propyl)amino]ethyl]-2-phenylmethoxyphenyl]urea.
| Compound Name | 1-methyl-3-[5-[2-[2-phenylethyl(propyl)amino]ethyl]-2-phenylmethoxyphenyl]urea |
|---|---|
| PubChem CID | 57124072 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-methyl-3-[5-[2-[2-phenylethyl(propyl)amino]ethyl]-2-phenylmethoxyphenyl]urea |
| SMILES | CCCN(CCc1ccccc1)CCc1ccc(OCc2ccccc2)c(NC(=O)NC)c1 |
| InChI | InChI=1S/C28H35N3O2/c1-3-18-31(19-16-23-10-6-4-7-11-23)20-17-24-14-15-27(26(21-24)30-28(32)29-2)33-22-25-12-8-5-9-13-25/h4-15,21H,3,16-20,22H2,1-2H3,(H2,29,30,32) |
| InChIKey | UKAIVWHOUAOLQC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |