C22H32BrN3O2 — CID 70412138
[2-hydroxy-5-[2-[4-phenylbutyl(propyl)amino]ethyl]phenyl]urea;hydrobromide (PubChem CID 70412138) has the molecular formula C22H32BrN3O2 and a molecular weight of 450.42 g/mol. Its IUPAC name is [2-hydroxy-5-[2-[4-phenylbutyl(propyl)amino]ethyl]phenyl]urea;hydrobromide.
| Compound Name | [2-hydroxy-5-[2-[4-phenylbutyl(propyl)amino]ethyl]phenyl]urea;hydrobromide |
|---|---|
| PubChem CID | 70412138 |
| Molecular Formula | C22H32BrN3O2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [2-hydroxy-5-[2-[4-phenylbutyl(propyl)amino]ethyl]phenyl]urea;hydrobromide |
| SMILES | Br.CCCN(CCCCc1ccccc1)CCc1ccc(O)c(NC(N)=O)c1 |
| InChI | InChI=1S/C22H31N3O2.BrH/c1-2-14-25(15-7-6-10-18-8-4-3-5-9-18)16-13-19-11-12-21(26)20(17-19)24-22(23)27;/h3-5,8-9,11-12,17,26H,2,6-7,10,13-16H2,1H3,(H3,23,24,27);1H |
| InChIKey | WJKAJAWPVGQRBH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|