C26H29NO3 — CID 15106554
N-(2-hydroxy-5-propylphenyl)-4-(4-phenylbutoxy)benzamide (PubChem CID 15106554) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-(2-hydroxy-5-propylphenyl)-4-(4-phenylbutoxy)benzamide.
| Compound Name | N-(2-hydroxy-5-propylphenyl)-4-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 15106554 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-(2-hydroxy-5-propylphenyl)-4-(4-phenylbutoxy)benzamide |
| SMILES | CCCc1ccc(O)c(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H29NO3/c1-2-8-21-12-17-25(28)24(19-21)27-26(29)22-13-15-23(16-14-22)30-18-7-6-11-20-9-4-3-5-10-20/h3-5,9-10,12-17,19,28H,2,6-8,11,18H2,1H3,(H,27,29) |
| InChIKey | BKOASHDUGHAMTB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|