C27H31ClN2O5 — CID 19882680
ethyl 2-[4-amino-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate;hydrochloride (PubChem CID 19882680) has the molecular formula C27H31ClN2O5 and a molecular weight of 499.01 g/mol. Its IUPAC name is ethyl 2-[4-amino-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-amino-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 19882680 |
| Molecular Formula | C27H31ClN2O5 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | ethyl 2-[4-amino-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate;hydrochloride |
| SMILES | CCOC(=O)COc1ccc(N)cc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H30N2O5.ClH/c1-2-32-26(30)19-34-25-16-13-22(28)18-24(25)29-27(31)21-11-14-23(15-12-21)33-17-7-6-10-20-8-4-3-5-9-20;/h3-5,8-9,11-16,18H,2,6-7,10,17,19,28H2,1H3,(H,29,31);1H |
| InChIKey | CHEAIYGHMAXDGH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|