C30H34ClNO5S — CID 15106478
ethyl 2-[3-[4-chloro-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]propylsulfanyl]acetate (PubChem CID 15106478) has the molecular formula C30H34ClNO5S and a molecular weight of 556.12 g/mol. Its IUPAC name is ethyl 2-[3-[4-chloro-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]propylsulfanyl]acetate.
| Compound Name | ethyl 2-[3-[4-chloro-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]propylsulfanyl]acetate |
|---|---|
| PubChem CID | 15106478 |
| Molecular Formula | C30H34ClNO5S |
| Molecular Weight | 556.12 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | ethyl 2-[3-[4-chloro-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]propylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCCCOc1ccc(Cl)cc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H34ClNO5S/c1-2-35-29(33)22-38-20-8-19-37-28-17-14-25(31)21-27(28)32-30(34)24-12-15-26(16-13-24)36-18-7-6-11-23-9-4-3-5-10-23/h3-5,9-10,12-17,21H,2,6-8,11,18-20,22H2,1H3,(H,32,34) |
| InChIKey | FXUPFLZTISOHGV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.12 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|