C29H32N2O6 — CID 15106500
ethyl 2-[4-acetamido-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate (PubChem CID 15106500) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is ethyl 2-[4-acetamido-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-acetamido-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 15106500 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | ethyl 2-[4-acetamido-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(C)=O)cc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O6/c1-3-35-28(33)20-37-27-17-14-24(30-21(2)32)19-26(27)31-29(34)23-12-15-25(16-13-23)36-18-8-7-11-22-9-5-4-6-10-22/h4-6,9-10,12-17,19H,3,7-8,11,18,20H2,1-2H3,(H,30,32)(H,31,34) |
| InChIKey | UYPSMIDUCINMLS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|