C28H28N2O8 — CID 15106511
3-[4-(carboxymethoxy)-3-[[4-(4-phenylbutoxy)benzoyl]amino]anilino]-3-oxopropanoic acid (PubChem CID 15106511) has the molecular formula C28H28N2O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is 3-[4-(carboxymethoxy)-3-[[4-(4-phenylbutoxy)benzoyl]amino]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-(carboxymethoxy)-3-[[4-(4-phenylbutoxy)benzoyl]amino]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 15106511 |
| Molecular Formula | C28H28N2O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3-[4-(carboxymethoxy)-3-[[4-(4-phenylbutoxy)benzoyl]amino]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)CC(=O)O)cc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O8/c31-25(17-26(32)33)29-21-11-14-24(38-18-27(34)35)23(16-21)30-28(36)20-9-12-22(13-10-20)37-15-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,9-14,16H,4-5,8,15,17-18H2,(H,29,31)(H,30,36)(H,32,33)(H,34,35) |
| InChIKey | HBVNAWHGFNDZBN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|