C27H29NO5 — CID 15106504
2-[4-ethyl-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetic acid (PubChem CID 15106504) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[4-ethyl-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-ethyl-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 15106504 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[4-ethyl-2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetic acid |
| SMILES | CCc1ccc(OCC(=O)O)c(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H29NO5/c1-2-20-11-16-25(33-19-26(29)30)24(18-20)28-27(31)22-12-14-23(15-13-22)32-17-7-6-10-21-8-4-3-5-9-21/h3-5,8-9,11-16,18H,2,6-7,10,17,19H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | VHZZKQBZMDQMSA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|