C33H37NO10 — CID 15106525
ethyl 2-[4-[2-(2-ethoxy-2-oxoethoxy)-2-oxoethoxy]-3-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate (PubChem CID 15106525) has the molecular formula C33H37NO10 and a molecular weight of 607.66 g/mol. Its IUPAC name is ethyl 2-[4-[2-(2-ethoxy-2-oxoethoxy)-2-oxoethoxy]-3-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(2-ethoxy-2-oxoethoxy)-2-oxoethoxy]-3-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 15106525 |
| Molecular Formula | C33H37NO10 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | ethyl 2-[4-[2-(2-ethoxy-2-oxoethoxy)-2-oxoethoxy]-3-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COC(=O)COc1ccc(OCC(=O)OCC)cc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H37NO10/c1-3-39-30(35)21-42-27-17-18-29(43-22-32(37)44-23-31(36)40-4-2)28(20-27)34-33(38)25-13-15-26(16-14-25)41-19-9-8-12-24-10-6-5-7-11-24/h5-7,10-11,13-18,20H,3-4,8-9,12,19,21-23H2,1-2H3,(H,34,38) |
| InChIKey | ZFGNOIZLKTVPMK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|