C30H39N3O2 — CID 54410248
1-[5-[2-[butyl-[2-(4-methylphenyl)ethyl]amino]ethyl]-2-phenylmethoxyphenyl]-3-methylurea (PubChem CID 54410248) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 1-[5-[2-[butyl-[2-(4-methylphenyl)ethyl]amino]ethyl]-2-phenylmethoxyphenyl]-3-methylurea.
| Compound Name | 1-[5-[2-[butyl-[2-(4-methylphenyl)ethyl]amino]ethyl]-2-phenylmethoxyphenyl]-3-methylurea |
|---|---|
| PubChem CID | 54410248 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 1-[5-[2-[butyl-[2-(4-methylphenyl)ethyl]amino]ethyl]-2-phenylmethoxyphenyl]-3-methylurea |
| SMILES | CCCCN(CCc1ccc(C)cc1)CCc1ccc(OCc2ccccc2)c(NC(=O)NC)c1 |
| InChI | InChI=1S/C30H39N3O2/c1-4-5-19-33(20-17-25-13-11-24(2)12-14-25)21-18-26-15-16-29(28(22-26)32-30(34)31-3)35-23-27-9-7-6-8-10-27/h6-16,22H,4-5,17-21,23H2,1-3H3,(H2,31,32,34) |
| InChIKey | VTPKKBOLNGVECD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |