C36H36N4O4 — CID 70142917
(2R)-2-[benzyl-[2,2-bis(4-aminophenyl)ethyl]amino]-2-(3-nitro-4-phenylmethoxyphenyl)ethanol (PubChem CID 70142917) has the molecular formula C36H36N4O4 and a molecular weight of 588.71 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2,2-bis(4-aminophenyl)ethyl]amino]-2-(3-nitro-4-phenylmethoxyphenyl)ethanol.
| Compound Name | (2R)-2-[benzyl-[2,2-bis(4-aminophenyl)ethyl]amino]-2-(3-nitro-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 70142917 |
| Molecular Formula | C36H36N4O4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | (2R)-2-[benzyl-[2,2-bis(4-aminophenyl)ethyl]amino]-2-(3-nitro-4-phenylmethoxyphenyl)ethanol |
| SMILES | Nc1ccc(C(CN(Cc2ccccc2)[C@@H](CO)c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C36H36N4O4/c37-31-16-11-28(12-17-31)33(29-13-18-32(38)19-14-29)23-39(22-26-7-3-1-4-8-26)35(24-41)30-15-20-36(34(21-30)40(42)43)44-25-27-9-5-2-6-10-27/h1-21,33,35,41H,22-25,37-38H2/t35-/m0/s1 |
| InChIKey | YAYODNHBGZNOFC-DHUJRADRSA-N |
| XLogP | 6.71 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|