C33H35N3O5 — CID 54019489
N-[4-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]propyl]phenyl]acetamide (PubChem CID 54019489) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is N-[4-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]propyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]propyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54019489 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-[4-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]propyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(C)N(Cc2ccccc2)CC(O)c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H35N3O5/c1-24(19-26-13-16-30(17-14-26)34-25(2)37)35(21-27-9-5-3-6-10-27)22-32(38)29-15-18-33(31(20-29)36(39)40)41-23-28-11-7-4-8-12-28/h3-18,20,24,32,38H,19,21-23H2,1-2H3,(H,34,37) |
| InChIKey | KXYGQIKIKYYKOT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|