C26H29BN2O5 — CID 163494552
2-[1-(4-methoxyphenyl)propan-2-yl-methylideneboranylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol (PubChem CID 163494552) has the molecular formula C26H29BN2O5 and a molecular weight of 460.34 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)propan-2-yl-methylideneboranylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol.
| Compound Name | 2-[1-(4-methoxyphenyl)propan-2-yl-methylideneboranylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 163494552 |
| Molecular Formula | C26H29BN2O5 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)propan-2-yl-methylideneboranylamino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanol |
| SMILES | C=BN(CC(O)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H29BN2O5/c1-19(15-20-9-12-23(33-3)13-10-20)28(27-2)17-25(30)22-11-14-26(24(16-22)29(31)32)34-18-21-7-5-4-6-8-21/h4-14,16,19,25,30H,2,15,17-18H2,1,3H3 |
| InChIKey | CPOMQHGDFKJFPS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|