C29H35N3O6 — CID 25133563
tert-butyl N-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]ethyl]carbamate (PubChem CID 25133563) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 25133563 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | tert-butyl N-[2-[benzyl-[2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1ccccc1)CC(O)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H35N3O6/c1-29(2,3)38-28(34)30-16-17-31(19-22-10-6-4-7-11-22)20-26(33)24-14-15-27(25(18-24)32(35)36)37-21-23-12-8-5-9-13-23/h4-15,18,26,33H,16-17,19-21H2,1-3H3,(H,30,34) |
| InChIKey | YHODKPKISNNXJB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|