C21H27N3O6 — CID 23529481
tert-butyl N-[2-hydroxy-3-(4-nitro-3-phenylmethoxyanilino)propyl]carbamate (PubChem CID 23529481) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-3-(4-nitro-3-phenylmethoxyanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-3-(4-nitro-3-phenylmethoxyanilino)propyl]carbamate |
|---|---|
| PubChem CID | 23529481 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | tert-butyl N-[2-hydroxy-3-(4-nitro-3-phenylmethoxyanilino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)CNc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H27N3O6/c1-21(2,3)30-20(26)23-13-17(25)12-22-16-9-10-18(24(27)28)19(11-16)29-14-15-7-5-4-6-8-15/h4-11,17,22,25H,12-14H2,1-3H3,(H,23,26) |
| InChIKey | KZMYRDOXWIMDEP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|