C46H52N4O8 — CID 70144295
tert-butyl N-[4-[2-[benzyl-[(2R)-2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]-1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl]phenyl]carbamate (PubChem CID 70144295) has the molecular formula C46H52N4O8 and a molecular weight of 788.94 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[benzyl-[(2R)-2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]-1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[benzyl-[(2R)-2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]-1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 70144295 |
| Molecular Formula | C46H52N4O8 |
| Molecular Weight | 788.94 g/mol |
| Exact Mass | 788.38 |
| IUPAC Name | tert-butyl N-[4-[2-[benzyl-[(2R)-2-hydroxy-2-(3-nitro-4-phenylmethoxyphenyl)ethyl]amino]-1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(CN(Cc2ccccc2)C[C@H](O)c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)c2ccc(NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H52N4O8/c1-45(2,3)57-43(52)47-37-22-17-34(18-23-37)39(35-19-24-38(25-20-35)48-44(53)58-46(4,5)6)29-49(28-32-13-9-7-10-14-32)30-41(51)36-21-26-42(40(27-36)50(54)55)56-31-33-15-11-8-12-16-33/h7-27,39,41,51H,28-31H2,1-6H3,(H,47,52)(H,48,53)/t41-/m0/s1 |
| InChIKey | MYRVEHKZPYKILT-RWYGWLOXSA-N |
| XLogP | 10.24 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.94 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|