C25H26N2O5S — CID 69300360
tert-butyl N-[4-[2-nitro-4-(2-phenylethoxy)phenyl]sulfanylphenyl]carbamate (PubChem CID 69300360) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is tert-butyl N-[4-[2-nitro-4-(2-phenylethoxy)phenyl]sulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-nitro-4-(2-phenylethoxy)phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 69300360 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | tert-butyl N-[4-[2-nitro-4-(2-phenylethoxy)phenyl]sulfanylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Sc2ccc(OCCc3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-25(2,3)32-24(28)26-19-9-12-21(13-10-19)33-23-14-11-20(17-22(23)27(29)30)31-16-15-18-7-5-4-6-8-18/h4-14,17H,15-16H2,1-3H3,(H,26,28) |
| InChIKey | BELMGWHITWOIRG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|