C24H30N2O4 — CID 22988463
tert-butyl N-[4-[2-[4-(2-cyano-2-ethoxyethyl)phenoxy]ethyl]phenyl]carbamate (PubChem CID 22988463) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-(2-cyano-2-ethoxyethyl)phenoxy]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-(2-cyano-2-ethoxyethyl)phenoxy]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 22988463 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl N-[4-[2-[4-(2-cyano-2-ethoxyethyl)phenoxy]ethyl]phenyl]carbamate |
| SMILES | CCOC(C#N)Cc1ccc(OCCc2ccc(NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-5-28-22(17-25)16-19-8-12-21(13-9-19)29-15-14-18-6-10-20(11-7-18)26-23(27)30-24(2,3)4/h6-13,22H,5,14-16H2,1-4H3,(H,26,27) |
| InChIKey | PINIDKILHDGNPY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |