C25H33NO5 — CID 54139683
ethyl (2S)-2-ethoxy-3-[4-[2-[4-(2-methylpropanoylamino)phenyl]ethoxy]phenyl]propanoate (PubChem CID 54139683) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-[2-[4-(2-methylpropanoylamino)phenyl]ethoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-[2-[4-(2-methylpropanoylamino)phenyl]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 54139683 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-[2-[4-(2-methylpropanoylamino)phenyl]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCc2ccc(NC(=O)C(C)C)cc2)cc1)OCC |
| InChI | InChI=1S/C25H33NO5/c1-5-29-23(25(28)30-6-2)17-20-9-13-22(14-10-20)31-16-15-19-7-11-21(12-8-19)26-24(27)18(3)4/h7-14,18,23H,5-6,15-17H2,1-4H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | OAFAOMYBIZKWPY-QHCPKHFHSA-N |
| XLogP | 4.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |