C21H27NO6S — CID 175073287
[4-[2-[4-[2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl]methanesulfonic acid (PubChem CID 175073287) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is [4-[2-[4-[2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl]methanesulfonic acid.
| Compound Name | [4-[2-[4-[2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 175073287 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [4-[2-[4-[2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl]methanesulfonic acid |
| SMILES | CCOC(Cc1ccc(OCCc2ccc(CS(=O)(=O)O)cc2)cc1)C(=O)NC |
| InChI | InChI=1S/C21H27NO6S/c1-3-27-20(21(23)22-2)14-17-8-10-19(11-9-17)28-13-12-16-4-6-18(7-5-16)15-29(24,25)26/h4-11,20H,3,12-15H2,1-2H3,(H,22,23)(H,24,25,26) |
| InChIKey | SEFMCUMZVDCDDG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|