C21H27NO7S — CID 123170529
[4-[2-[4-[2-ethoxy-3-(methoxyamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate (PubChem CID 123170529) has the molecular formula C21H27NO7S and a molecular weight of 437.51 g/mol. Its IUPAC name is [4-[2-[4-[2-ethoxy-3-(methoxyamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate.
| Compound Name | [4-[2-[4-[2-ethoxy-3-(methoxyamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 123170529 |
| Molecular Formula | C21H27NO7S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [4-[2-[4-[2-ethoxy-3-(methoxyamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate |
| SMILES | CCOC(Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)NOC |
| InChI | InChI=1S/C21H27NO7S/c1-4-27-20(21(23)22-26-2)15-17-7-9-18(10-8-17)28-14-13-16-5-11-19(12-6-16)29-30(3,24)25/h5-12,20H,4,13-15H2,1-3H3,(H,22,23) |
| InChIKey | AMMVQSNUNXRUFR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|