C21H26O6S — CID 150637391
3-methyl-2-[[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]butanoic acid (PubChem CID 150637391) has the molecular formula C21H26O6S and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-methyl-2-[[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 150637391 |
| Molecular Formula | C21H26O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-methyl-2-[[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]butanoic acid |
| SMILES | CC(C)C(Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H26O6S/c1-15(2)20(21(22)23)14-17-6-8-18(9-7-17)26-13-12-16-4-10-19(11-5-16)27-28(3,24)25/h4-11,15,20H,12-14H2,1-3H3,(H,22,23) |
| InChIKey | IZEFQFVGRZKXQK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|