C34H44O6S3 — CID 11643158
S-octyl (2S)-2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanethioate (PubChem CID 11643158) has the molecular formula C34H44O6S3 and a molecular weight of 644.92 g/mol. Its IUPAC name is S-octyl (2S)-2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanethioate.
| Compound Name | S-octyl (2S)-2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanethioate |
|---|---|
| PubChem CID | 11643158 |
| Molecular Formula | C34H44O6S3 |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | S-octyl (2S)-2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanethioate |
| SMILES | CCCCCCCCSC(=O)[C@H](Cc1ccc(CCOc2ccc(OS(C)(=O)=O)cc2)cc1)SCCc1ccc(O)cc1 |
| InChI | InChI=1S/C34H44O6S3/c1-3-4-5-6-7-8-24-42-34(36)33(41-25-22-28-13-15-30(35)16-14-28)26-29-11-9-27(10-12-29)21-23-39-31-17-19-32(20-18-31)40-43(2,37)38/h9-20,33,35H,3-8,21-26H2,1-2H3/t33-/m0/s1 |
| InChIKey | WEZBLYCRMXJELQ-XIFFEERXSA-N |
| XLogP | 7.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|