C26H28O5S2 — CID 143243275
2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfanyloxyphenoxy)ethyl]phenyl]propanoic acid (PubChem CID 143243275) has the molecular formula C26H28O5S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfanyloxyphenoxy)ethyl]phenyl]propanoic acid.
| Compound Name | 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfanyloxyphenoxy)ethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143243275 |
| Molecular Formula | C26H28O5S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfanyloxyphenoxy)ethyl]phenyl]propanoic acid |
| SMILES | CSOc1ccc(OCCc2ccc(CC(SCCc3ccc(O)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H28O5S2/c1-32-31-24-12-10-23(11-13-24)30-16-14-19-2-4-21(5-3-19)18-25(26(28)29)33-17-15-20-6-8-22(27)9-7-20/h2-13,25,27H,14-18H2,1H3,(H,28,29) |
| InChIKey | IHWXWHTYAUXKAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|