C30H38O7S2Si — CID 59798411
trimethylsilyl 2-[2-(4-methoxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate (PubChem CID 59798411) has the molecular formula C30H38O7S2Si and a molecular weight of 602.85 g/mol. Its IUPAC name is trimethylsilyl 2-[2-(4-methoxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate.
| Compound Name | trimethylsilyl 2-[2-(4-methoxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 59798411 |
| Molecular Formula | C30H38O7S2Si |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | trimethylsilyl 2-[2-(4-methoxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate |
| SMILES | COc1ccc(CCSC(Cc2ccc(CCOc3ccc(OS(C)(=O)=O)cc3)cc2)C(=O)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C30H38O7S2Si/c1-34-26-12-10-24(11-13-26)19-21-38-29(30(31)37-40(3,4)5)22-25-8-6-23(7-9-25)18-20-35-27-14-16-28(17-15-27)36-39(2,32)33/h6-17,29H,18-22H2,1-5H3 |
| InChIKey | JBUVLFIJDDHZIR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|