C29H32O7S2 — CID 87500760
prop-2-enyl 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate (PubChem CID 87500760) has the molecular formula C29H32O7S2 and a molecular weight of 556.70 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate.
| Compound Name | prop-2-enyl 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 87500760 |
| Molecular Formula | C29H32O7S2 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | prop-2-enyl 2-[2-(4-hydroxyphenyl)ethylsulfanyl]-3-[4-[2-(4-methylsulfonyloxyphenoxy)ethyl]phenyl]propanoate |
| SMILES | C=CCOC(=O)C(Cc1ccc(CCOc2ccc(OS(C)(=O)=O)cc2)cc1)SCCc1ccc(O)cc1 |
| InChI | InChI=1S/C29H32O7S2/c1-3-18-35-29(31)28(37-20-17-23-8-10-25(30)11-9-23)21-24-6-4-22(5-7-24)16-19-34-26-12-14-27(15-13-26)36-38(2,32)33/h3-15,28,30H,1,16-21H2,2H3 |
| InChIKey | PFNVZLWOOYERKZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|