C21H29NO6S — CID 153338414
[4-[2-[4-[(2S)-2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate;molecular hydrogen (PubChem CID 153338414) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is [4-[2-[4-[(2S)-2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate;molecular hydrogen.
| Compound Name | [4-[2-[4-[(2S)-2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate;molecular hydrogen |
|---|---|
| PubChem CID | 153338414 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [4-[2-[4-[(2S)-2-ethoxy-3-(methylamino)-3-oxopropyl]phenoxy]ethyl]phenyl] methanesulfonate;molecular hydrogen |
| SMILES | CCO[C@@H](Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)NC.[H][H] |
| InChI | InChI=1S/C21H27NO6S.H2/c1-4-26-20(21(23)22-2)15-17-7-9-18(10-8-17)27-14-13-16-5-11-19(12-6-16)28-29(3,24)25;/h5-12,20H,4,13-15H2,1-3H3,(H,22,23);1H/t20-;/m0./s1 |
| InChIKey | WLQFRPQBMUIUBH-BDQAORGHSA-N |
| XLogP | 2.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|