C23H29NO7S — CID 10217199
ethyl 2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propanoylamino]phenyl]propanoate (PubChem CID 10217199) has the molecular formula C23H29NO7S and a molecular weight of 463.55 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propanoylamino]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propanoylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 10217199 |
| Molecular Formula | C23H29NO7S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propanoylamino]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(NC(=O)CCc2ccc(OS(C)(=O)=O)cc2)cc1)OCC |
| InChI | InChI=1S/C23H29NO7S/c1-4-29-21(23(26)30-5-2)16-18-6-11-19(12-7-18)24-22(25)15-10-17-8-13-20(14-9-17)31-32(3,27)28/h6-9,11-14,21H,4-5,10,15-16H2,1-3H3,(H,24,25) |
| InChIKey | IDZPFZHXIPXQKL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|