C28H41N5O10S — CID 10439118
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoic acid (PubChem CID 10439118) has the molecular formula C28H41N5O10S and a molecular weight of 639.73 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10439118 |
| Molecular Formula | C28H41N5O10S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-ethoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propoxycarbonylamino]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(NC(=O)OCCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C22H27NO8S.C6H14N4O2/c1-3-29-20(21(24)25)15-17-6-10-18(11-7-17)23-22(26)30-14-4-5-16-8-12-19(13-9-16)31-32(2,27)28;7-4(5(11)12)2-1-3-10-6(8)9/h6-13,20H,3-5,14-15H2,1-2H3,(H,23,26)(H,24,25);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | GFIAJLDSXDVRJF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 255.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|